C18H23N3O3 — CID 4648254
3-[2-oxo-2-(4-propylpiperazin-1-yl)ethyl]-1H-indole-2-carboxylic acid (PubChem CID 4648254) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[2-oxo-2-(4-propylpiperazin-1-yl)ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-oxo-2-(4-propylpiperazin-1-yl)ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 4648254 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[2-oxo-2-(4-propylpiperazin-1-yl)ethyl]-1H-indole-2-carboxylic acid |
| SMILES | CCCN1CCN(C(=O)Cc2c(C(=O)O)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-7-20-8-10-21(11-9-20)16(22)12-14-13-5-3-4-6-15(13)19-17(14)18(23)24/h3-6,19H,2,7-12H2,1H3,(H,23,24) |
| InChIKey | FEUGXHQHMCTFQI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|