C15H15N2O4- — CID 4688270
3-(2-morpholin-4-yl-2-oxoethyl)-1H-indole-2-carboxylate (PubChem CID 4688270) has the molecular formula C15H15N2O4- and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-oxoethyl)-1H-indole-2-carboxylate.
| Compound Name | 3-(2-morpholin-4-yl-2-oxoethyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4688270 |
| Molecular Formula | C15H15N2O4- |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-oxoethyl)-1H-indole-2-carboxylate |
| SMILES | O=C([O-])c1[nH]c2ccccc2c1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H16N2O4/c18-13(17-5-7-21-8-6-17)9-11-10-3-1-2-4-12(10)16-14(11)15(19)20/h1-4,16H,5-9H2,(H,19,20)/p-1 |
| InChIKey | VCGHFABJIIJSDT-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|