C18H15FN2O3 — CID 46484257
3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methylquinazolin-4-one (PubChem CID 46484257) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methylquinazolin-4-one.
| Compound Name | 3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methylquinazolin-4-one |
|---|---|
| PubChem CID | 46484257 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methylquinazolin-4-one |
| SMILES | COc1ccc(F)cc1C(=O)Cn1cnc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C18H15FN2O3/c1-11-3-5-15-13(7-11)18(23)21(10-20-15)9-16(22)14-8-12(19)4-6-17(14)24-2/h3-8,10H,9H2,1-2H3 |
| InChIKey | TYASJQDTDMAUMD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |