C18H15BrN2O2 — CID 7488393
6-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one (PubChem CID 7488393) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is 6-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7488393 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 6-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one |
| SMILES | Cc1ccc(C(=O)Cn2cnc3ccc(Br)cc3c2=O)c(C)c1 |
| InChI | InChI=1S/C18H15BrN2O2/c1-11-3-5-14(12(2)7-11)17(22)9-21-10-20-16-6-4-13(19)8-15(16)18(21)23/h3-8,10H,9H2,1-2H3 |
| InChIKey | LLESOVUODOSTEB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |