C14H13BrN2O2 — CID 66310833
5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]pyrimidin-4-one (PubChem CID 66310833) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]pyrimidin-4-one.
| Compound Name | 5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 66310833 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]pyrimidin-4-one |
| SMILES | Cc1ccc(C(=O)Cn2cncc(Br)c2=O)c(C)c1 |
| InChI | InChI=1S/C14H13BrN2O2/c1-9-3-4-11(10(2)5-9)13(18)7-17-8-16-6-12(15)14(17)19/h3-6,8H,7H2,1-2H3 |
| InChIKey | CPPBLIUTHWMWGL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |