C19H16F4N2O3 — CID 46485651
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 46485651) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46485651 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F4N2O3/c20-12-4-3-11(13(6-12)19(21,22)23)7-24-14(26)8-25-17(27)15-9-1-2-10(5-9)16(15)18(25)28/h1-4,6,9-10,15-16H,5,7-8H2,(H,24,26) |
| InChIKey | WRQSDBPZBXPJDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|