C18H17FN2O4 — CID 98407874
2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-fluoro-2-methoxyphenyl)acetamide (PubChem CID 98407874) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-fluoro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-fluoro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98407874 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-fluoro-2-methoxyphenyl)acetamide |
| SMILES | COc1cc(F)ccc1NC(=O)CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C18H17FN2O4/c1-25-13-7-11(19)4-5-12(13)20-14(22)8-21-17(23)15-9-2-3-10(6-9)16(15)18(21)24/h2-5,7,9-10,15-16H,6,8H2,1H3,(H,20,22)/t9-,10-,15-,16+/m0/s1 |
| InChIKey | ABUURBBDRLPNGQ-VUKUWZNJSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|