C23H19ClN2O4 — CID 55439218
N-[2-(2-chlorophenoxy)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide (PubChem CID 55439218) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide.
| Compound Name | N-[2-(2-chlorophenoxy)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide |
|---|---|
| PubChem CID | 55439218 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[2-(2-chlorophenoxy)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccccc1Oc1ccccc1Cl |
| InChI | InChI=1S/C23H19ClN2O4/c24-15-5-1-3-7-17(15)30-18-8-4-2-6-16(18)25-19(27)12-26-22(28)20-13-9-10-14(11-13)21(20)23(26)29/h1-10,13-14,20-21H,11-12H2,(H,25,27) |
| InChIKey | ZMVLKVQWHLFZHY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|