C18H24FN3O — CID 46486795
1-tert-butyl-N-[(2-fluorophenyl)methyl]-5-propan-2-ylpyrazole-3-carboxamide (PubChem CID 46486795) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-tert-butyl-N-[(2-fluorophenyl)methyl]-5-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[(2-fluorophenyl)methyl]-5-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46486795 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-tert-butyl-N-[(2-fluorophenyl)methyl]-5-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCc2ccccc2F)nn1C(C)(C)C |
| InChI | InChI=1S/C18H24FN3O/c1-12(2)16-10-15(21-22(16)18(3,4)5)17(23)20-11-13-8-6-7-9-14(13)19/h6-10,12H,11H2,1-5H3,(H,20,23) |
| InChIKey | BCDIIVPNXCGWLX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |