C20H19N5O7 — CID 46494459
N-(2-amino-2-oxoethyl)-4-[[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]methyl]benzamide (PubChem CID 46494459) has the molecular formula C20H19N5O7 and a molecular weight of 441.40 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46494459 |
| Molecular Formula | C20H19N5O7 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C20H19N5O7/c21-17(26)9-23-20(29)13-3-1-12(2-4-13)8-22-18(27)10-24-15-7-14(25(30)31)5-6-16(15)32-11-19(24)28/h1-7H,8-11H2,(H2,21,26)(H,22,27)(H,23,29) |
| InChIKey | IYGIUTYBCVZOHR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|