C31H42O11 — CID 46494891
4-[[(9S)-16-(3-carboxypropanoyloxy)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 46494891) has the molecular formula C31H42O11 and a molecular weight of 590.67 g/mol. Its IUPAC name is 4-[[(9S)-16-(3-carboxypropanoyloxy)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(9S)-16-(3-carboxypropanoyloxy)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 46494891 |
| Molecular Formula | C31H42O11 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 4-[[(9S)-16-(3-carboxypropanoyloxy)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC12CCC(OC(=O)CCC(=O)O)CC1CCC1[C@@H]2CCC2(C)C(C3=CC(=O)OC3)C(OC(=O)CCC(=O)O)CC12O |
| InChI | InChI=1S/C31H42O11/c1-29-11-9-19(41-25(36)7-5-23(32)33)14-18(29)3-4-21-20(29)10-12-30(2)28(17-13-27(38)40-16-17)22(15-31(21,30)39)42-26(37)8-6-24(34)35/h13,18-22,28,39H,3-12,14-16H2,1-2H3,(H,32,33)(H,34,35)/t18?,19?,20-,21?,22?,28?,29?,30?,31?/m0/s1 |
| InChIKey | CGRKHMRYKBJFLF-CFICNWLMSA-N |
| XLogP | 3.41 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|