C32H48N2O7 — CID 72680075
[16-acetyloxy-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methyl-1,4-diazepane-1-carboxylate (PubChem CID 72680075) has the molecular formula C32H48N2O7 and a molecular weight of 572.74 g/mol. Its IUPAC name is [16-acetyloxy-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methyl-1,4-diazepane-1-carboxylate.
| Compound Name | [16-acetyloxy-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 72680075 |
| Molecular Formula | C32H48N2O7 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | [16-acetyloxy-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methyl-1,4-diazepane-1-carboxylate |
| SMILES | CC(=O)OC1CC2(O)C3CCC4CC(OC(=O)N5CCCN(C)CC5)CCC4(C)C3CCC2(C)C1C1=CC(=O)OC1 |
| InChI | InChI=1S/C32H48N2O7/c1-20(35)40-26-18-32(38)25-7-6-22-17-23(41-29(37)34-13-5-12-33(4)14-15-34)8-10-30(22,2)24(25)9-11-31(32,3)28(26)21-16-27(36)39-19-21/h16,22-26,28,38H,5-15,17-19H2,1-4H3 |
| InChIKey | WDVOJRSDMDTZLQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|