C20H15IN2O3 — CID 46498625
N-[(E)-3-anilino-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2-iodobenzamide (PubChem CID 46498625) has the molecular formula C20H15IN2O3 and a molecular weight of 458.26 g/mol. Its IUPAC name is N-[(E)-3-anilino-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2-iodobenzamide.
| Compound Name | N-[(E)-3-anilino-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 46498625 |
| Molecular Formula | C20H15IN2O3 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | N-[(E)-3-anilino-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2-iodobenzamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\c1ccco1)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C20H15IN2O3/c21-17-11-5-4-10-16(17)19(24)23-18(13-15-9-6-12-26-15)20(25)22-14-7-2-1-3-8-14/h1-13H,(H,22,25)(H,23,24)/b18-13+ |
| InChIKey | UFOKMKAKUHCCTN-QGOAFFKASA-N |
| XLogP | 4.29 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|