C53H38N4O6 — CID 71833282
N-[3-[4-[9-[4-[[2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]fluoren-9-yl]anilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 71833282) has the molecular formula C53H38N4O6 and a molecular weight of 826.91 g/mol. Its IUPAC name is N-[3-[4-[9-[4-[[2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]fluoren-9-yl]anilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[4-[9-[4-[[2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]fluoren-9-yl]anilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 71833282 |
| Molecular Formula | C53H38N4O6 |
| Molecular Weight | 826.91 g/mol |
| Exact Mass | 826.28 |
| IUPAC Name | N-[3-[4-[9-[4-[[2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]fluoren-9-yl]anilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C2(c3ccc(NC(=O)C(=Cc4ccco4)NC(=O)c4ccccc4)cc3)c3ccccc3-c3ccccc32)cc1)C(=Cc1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C53H38N4O6/c58-49(35-13-3-1-4-14-35)56-47(33-41-17-11-31-62-41)51(60)54-39-27-23-37(24-28-39)53(45-21-9-7-19-43(45)44-20-8-10-22-46(44)53)38-25-29-40(30-26-38)55-52(61)48(34-42-18-12-32-63-42)57-50(59)36-15-5-2-6-16-36/h1-34H,(H,54,60)(H,55,61)(H,56,58)(H,57,59) |
| InChIKey | YGRBLISYBOOWNM-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.91 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|