C15H11N5O5 — CID 46499488
(2Z)-2-nitro-2-(5-nitro-1,3-dihydrobenzimidazol-2-ylidene)-N-phenylacetamide (PubChem CID 46499488) has the molecular formula C15H11N5O5 and a molecular weight of 341.28 g/mol. Its IUPAC name is (2Z)-2-nitro-2-(5-nitro-1,3-dihydrobenzimidazol-2-ylidene)-N-phenylacetamide.
| Compound Name | (2Z)-2-nitro-2-(5-nitro-1,3-dihydrobenzimidazol-2-ylidene)-N-phenylacetamide |
|---|---|
| PubChem CID | 46499488 |
| Molecular Formula | C15H11N5O5 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2Z)-2-nitro-2-(5-nitro-1,3-dihydrobenzimidazol-2-ylidene)-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)/C(=C1\Nc2ccc([N+](=O)[O-])cc2N1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N5O5/c21-15(16-9-4-2-1-3-5-9)13(20(24)25)14-17-11-7-6-10(19(22)23)8-12(11)18-14/h1-8,17-18H,(H,16,21)/b14-13- |
| InChIKey | LFVBAAFGDVZYNQ-YPKPFQOOSA-N |
| XLogP | 2.52 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|