C27H25ClN4O2S — CID 46499706
(6Z)-6-[[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methylindol-3-yl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46499706) has the molecular formula C27H25ClN4O2S and a molecular weight of 505.04 g/mol. Its IUPAC name is (6Z)-6-[[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methylindol-3-yl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methylindol-3-yl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46499706 |
| Molecular Formula | C27H25ClN4O2S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | (6Z)-6-[[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methylindol-3-yl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2c(C)n(CCCOc3cc(C)c(Cl)c(C)c3)c3ccccc23)/C(=O)N=C2SC=CN2/1 |
| InChI | InChI=1S/C27H25ClN4O2S/c1-16-13-19(14-17(2)24(16)28)34-11-6-9-31-18(3)21(20-7-4-5-8-23(20)31)15-22-25(29)32-10-12-35-27(32)30-26(22)33/h4-5,7-8,10,12-15,29H,6,9,11H2,1-3H3/b22-15-,29-25- |
| InChIKey | GBCBLFAHUOCQIA-RORORGNRSA-N |
| XLogP | 6.47 |
| TPSA | 70.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|