C32H29N5O3S — CID 98472324
(6E)-6-[[1-[2-(2,4-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 98472324) has the molecular formula C32H29N5O3S and a molecular weight of 563.68 g/mol. Its IUPAC name is (6E)-6-[[1-[2-(2,4-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-[2-(2,4-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 98472324 |
| Molecular Formula | C32H29N5O3S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (6E)-6-[[1-[2-(2,4-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2c(C)n(CCOc3ccc(C)cc3C)c3ccccc23)/C(=O)N=C2SC(COc3ccccc3)=NN2/1 |
| InChI | InChI=1S/C32H29N5O3S/c1-20-13-14-28(21(2)17-20)39-16-15-36-22(3)25(24-11-7-8-12-27(24)36)18-26-30(33)37-32(34-31(26)38)41-29(35-37)19-40-23-9-5-4-6-10-23/h4-14,17-18,33H,15-16,19H2,1-3H3/b26-18+,33-30- |
| InChIKey | MIEDHKAJMBHMAG-QECCIRCESA-N |
| XLogP | 6.34 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|