C29H28F3N5O2S — CID 98235955
(6Z)-6-[[1-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 98235955) has the molecular formula C29H28F3N5O2S and a molecular weight of 567.64 g/mol. Its IUPAC name is (6Z)-6-[[1-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 98235955 |
| Molecular Formula | C29H28F3N5O2S |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | (6Z)-6-[[1-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2c(C)n(CCOc3ccc(C(C)(C)C)cc3)c3ccc(C)cc23)/C(=O)N=C2SC(C(F)(F)F)=NN2/1 |
| InChI | InChI=1S/C29H28F3N5O2S/c1-16-6-11-23-21(14-16)20(15-22-24(33)37-27(34-25(22)38)40-26(35-37)29(30,31)32)17(2)36(23)12-13-39-19-9-7-18(8-10-19)28(3,4)5/h6-11,14-15,33H,12-13H2,1-5H3/b22-15-,33-24- |
| InChIKey | FIXFSRSNIHQKCG-WHRAICGWSA-N |
| XLogP | 6.82 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|