C30H31N5O3S — CID 56727168
(6Z)-5-imino-6-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727168) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727168 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (6Z)-5-imino-6-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-2-methylindol-3-yl]methylidene]-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2c(C)n(CCOc3ccc(CC=C)cc3OC)c3ccccc23)/C(=O)N=C2SC(CCC)=NN2/1 |
| InChI | InChI=1S/C30H31N5O3S/c1-5-9-20-13-14-25(26(17-20)37-4)38-16-15-34-19(3)22(21-11-7-8-12-24(21)34)18-23-28(31)35-30(32-29(23)36)39-27(33-35)10-6-2/h5,7-8,11-14,17-18,31H,1,6,9-10,15-16H2,2-4H3/b23-18-,31-28- |
| InChIKey | QDTWBNAVWSBSND-ORVKBSBDSA-N |
| XLogP | 6.19 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|