C32H26N4O4S — CID 3801397
6-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3801397) has the molecular formula C32H26N4O4S and a molecular weight of 562.65 g/mol. Its IUPAC name is 6-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3801397 |
| Molecular Formula | C32H26N4O4S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 6-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2ccc(OCc3cccc4ccccc34)c(OCC)c2)C(=O)N=C2SC(COc3ccccc3)=NN21 |
| InChI | InChI=1S/C32H26N4O4S/c1-2-38-28-18-21(15-16-27(28)40-19-23-11-8-10-22-9-6-7-14-25(22)23)17-26-30(33)36-32(34-31(26)37)41-29(35-36)20-39-24-12-4-3-5-13-24/h3-18,33H,2,19-20H2,1H3/b26-17?,33-30- |
| InChIKey | PLKLPJNYUHZILB-RZGDGWSKSA-N |
| XLogP | 6.52 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|