C29H25ClN4O4S2 — CID 3330202
6-[[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3330202) has the molecular formula C29H25ClN4O4S2 and a molecular weight of 593.13 g/mol. Its IUPAC name is 6-[[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3330202 |
| Molecular Formula | C29H25ClN4O4S2 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | 6-[[4-[2-(4-chlorophenyl)sulfanylethoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(phenoxymethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCCSc3ccc(Cl)cc3)c(OCC)c2)C(=O)N=C2SC(COc3ccccc3)=NN21 |
| InChI | InChI=1S/C29H25ClN4O4S2/c1-2-36-25-17-19(8-13-24(25)37-14-15-39-22-11-9-20(30)10-12-22)16-23-27(31)34-29(32-28(23)35)40-26(33-34)18-38-21-6-4-3-5-7-21/h3-13,16-17,31H,2,14-15,18H2,1H3/b23-16?,31-27+ |
| InChIKey | LBYSLPVQBBNJKV-POMFCMIXSA-N |
| XLogP | 6.61 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|