C35H41N5O6S — CID 46504293
ethyl 4-[4-[2-(4-methoxyanilino)-2-oxoethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 46504293) has the molecular formula C35H41N5O6S and a molecular weight of 659.81 g/mol. Its IUPAC name is ethyl 4-[4-[2-(4-methoxyanilino)-2-oxoethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[2-(4-methoxyanilino)-2-oxoethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 46504293 |
| Molecular Formula | C35H41N5O6S |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | ethyl 4-[4-[2-(4-methoxyanilino)-2-oxoethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(CC(=O)Nc3ccc(OC)cc3)N(CCCN3CCN(c4ccc(OC)cc4)CC3)C2=S)cc1 |
| InChI | InChI=1S/C35H41N5O6S/c1-4-46-34(43)25-6-10-28(11-7-25)40-33(42)31(24-32(41)36-26-8-14-29(44-2)15-9-26)39(35(40)47)19-5-18-37-20-22-38(23-21-37)27-12-16-30(45-3)17-13-27/h6-17,31H,4-5,18-24H2,1-3H3,(H,36,41) |
| InChIKey | PUVQHTRFMXCNQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|