C29H25Cl5N4O5S — CID 99654985
ethyl 4-[(4R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5-oxo-3-[2-(2,3,4,5,6-pentachloroanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 99654985) has the molecular formula C29H25Cl5N4O5S and a molecular weight of 718.87 g/mol. Its IUPAC name is ethyl 4-[(4R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5-oxo-3-[2-(2,3,4,5,6-pentachloroanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(4R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5-oxo-3-[2-(2,3,4,5,6-pentachloroanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 99654985 |
| Molecular Formula | C29H25Cl5N4O5S |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 716.00 |
| IUPAC Name | ethyl 4-[(4R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5-oxo-3-[2-(2,3,4,5,6-pentachloroanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H](CC(=O)Nc3ccc(OC)cc3)N(CCNc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)C2=S)cc1 |
| InChI | InChI=1S/C29H25Cl5N4O5S/c1-3-43-28(41)15-4-8-17(9-5-15)38-27(40)19(14-20(39)36-16-6-10-18(42-2)11-7-16)37(29(38)44)13-12-35-26-24(33)22(31)21(30)23(32)25(26)34/h4-11,19,35H,3,12-14H2,1-2H3,(H,36,39)/t19-/m1/s1 |
| InChIKey | GTKJDBZTQMFEFV-LJQANCHMSA-N |
| XLogP | 7.58 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|