C21H20F2N4O3S — CID 46505440
2-[3-(2-acetamidoethyl)-1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 46505440) has the molecular formula C21H20F2N4O3S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-[3-(2-acetamidoethyl)-1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-(2-acetamidoethyl)-1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46505440 |
| Molecular Formula | C21H20F2N4O3S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[3-(2-acetamidoethyl)-1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)NCCN1C(=S)N(c2ccc(F)cc2)C(=O)C1CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20F2N4O3S/c1-13(28)24-10-11-26-18(12-19(29)25-16-6-2-14(22)3-7-16)20(30)27(21(26)31)17-8-4-15(23)5-9-17/h2-9,18H,10-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | XMUVBQHUCONNRV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|