C24H22N4O6S — CID 46506355
N-(4-methoxyphenyl)-4-[1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]butanamide (PubChem CID 46506355) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]butanamide.
| Compound Name | N-(4-methoxyphenyl)-4-[1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]butanamide |
|---|---|
| PubChem CID | 46506355 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]butanamide |
| SMILES | COc1ccc(NC(=O)CCCn2c(=O)c3sccc3n(Cc3ccc([N+](=O)[O-])cc3)c2=O)cc1 |
| InChI | InChI=1S/C24H22N4O6S/c1-34-19-10-6-17(7-11-19)25-21(29)3-2-13-26-23(30)22-20(12-14-35-22)27(24(26)31)15-16-4-8-18(9-5-16)28(32)33/h4-12,14H,2-3,13,15H2,1H3,(H,25,29) |
| InChIKey | MMWLSOXXGFWYKX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|