C33H30N6O3 — CID 4650852
3-[2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 4650852) has the molecular formula C33H30N6O3 and a molecular weight of 558.64 g/mol. Its IUPAC name is 3-[2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-[2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 4650852 |
| Molecular Formula | C33H30N6O3 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 3-[2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl]-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)C3N=NN(CC(=O)N4N=C5C(=Cc6ccccc6)CCCC5C4c4ccccc4)C3C2=O)cc1 |
| InChI | InChI=1S/C33H30N6O3/c1-21-15-17-25(18-16-21)38-32(41)29-31(33(38)42)37(36-34-29)20-27(40)39-30(23-11-6-3-7-12-23)26-14-8-13-24(28(26)35-39)19-22-9-4-2-5-10-22/h2-7,9-12,15-19,26,29-31H,8,13-14,20H2,1H3 |
| InChIKey | JTAMLKNTNNGGGG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|