C34H31ClN6O3 — CID 4992127
5-(4-chlorophenyl)-3-[2-[3-(4-methylphenyl)-7-[(4-methylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 4992127) has the molecular formula C34H31ClN6O3 and a molecular weight of 607.11 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[2-[3-(4-methylphenyl)-7-[(4-methylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[2-[3-(4-methylphenyl)-7-[(4-methylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 4992127 |
| Molecular Formula | C34H31ClN6O3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[2-[3-(4-methylphenyl)-7-[(4-methylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | Cc1ccc(C=C2CCCC3C2=NN(C(=O)CN2N=NC4C(=O)N(c5ccc(Cl)cc5)C(=O)C42)C3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H31ClN6O3/c1-20-6-10-22(11-7-20)18-24-4-3-5-27-29(24)37-41(31(27)23-12-8-21(2)9-13-23)28(42)19-39-32-30(36-38-39)33(43)40(34(32)44)26-16-14-25(35)15-17-26/h6-18,27,30-32H,3-5,19H2,1-2H3 |
| InChIKey | KHXCGYPXQWNXAK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|