C23H21N5O3 — CID 46509482
1-(5-cyano-2-pyridinyl)-N-[3-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide (PubChem CID 46509482) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N-[3-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N-[3-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46509482 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N-[3-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(N2CCC(C(=O)Nc3cccc(NC(=O)c4ccco4)c3)CC2)nc1 |
| InChI | InChI=1S/C23H21N5O3/c24-14-16-6-7-21(25-15-16)28-10-8-17(9-11-28)22(29)26-18-3-1-4-19(13-18)27-23(30)20-5-2-12-31-20/h1-7,12-13,15,17H,8-11H2,(H,26,29)(H,27,30) |
| InChIKey | JEMDNZIQMBVQQK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |