C21H23N5O3S — CID 46699660
1-(5-cyano-2-pyridinyl)-N-[3-(cyclopropylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 46699660) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N-[3-(cyclopropylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N-[3-(cyclopropylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46699660 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N-[3-(cyclopropylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(N2CCC(C(=O)Nc3cccc(S(=O)(=O)NC4CC4)c3)CC2)nc1 |
| InChI | InChI=1S/C21H23N5O3S/c22-13-15-4-7-20(23-14-15)26-10-8-16(9-11-26)21(27)24-18-2-1-3-19(12-18)30(28,29)25-17-5-6-17/h1-4,7,12,14,16-17,25H,5-6,8-11H2,(H,24,27) |
| InChIKey | ZYHXUBBTARWLEK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |