C21H25N5O3S — CID 16598548
1-(5-cyano-2-pyridinyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 16598548) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16598548 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)C2CCN(c3ccc(C#N)cn3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O3S/c1-15(2)25-30(28,29)19-6-4-18(5-7-19)24-21(27)17-9-11-26(12-10-17)20-8-3-16(13-22)14-23-20/h3-8,14-15,17,25H,9-12H2,1-2H3,(H,24,27) |
| InChIKey | BYPYYBPVAXRICX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |