C21H24N2O4S — CID 46518997
[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 46518997) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 46518997 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | CC(OC(=O)CCCNC(=O)c1ccsc1)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C21H24N2O4S/c1-15(21(26)23-12-5-7-16-6-2-3-8-18(16)23)27-19(24)9-4-11-22-20(25)17-10-13-28-14-17/h2-3,6,8,10,13-15H,4-5,7,9,11-12H2,1H3,(H,22,25) |
| InChIKey | NHVANHNPPHTCJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|