C23H25NO5 — CID 7196346
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(4-acetylphenoxy)butanoate (PubChem CID 7196346) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(4-acetylphenoxy)butanoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(4-acetylphenoxy)butanoate |
|---|---|
| PubChem CID | 7196346 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CC(=O)c1ccc(OCCCC(=O)O[C@H](C)C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-16(25)18-9-11-20(12-10-18)28-15-5-8-22(26)29-17(2)23(27)24-14-13-19-6-3-4-7-21(19)24/h3-4,6-7,9-12,17H,5,8,13-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | DHGPBXJVQYHUAW-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|