C17H29N5O2S — CID 46528202
3-[3-cyclopropyl-5-[2-(heptan-2-ylamino)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide (PubChem CID 46528202) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-[2-(heptan-2-ylamino)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-cyclopropyl-5-[2-(heptan-2-ylamino)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46528202 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 3-[3-cyclopropyl-5-[2-(heptan-2-ylamino)-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
| SMILES | CCCCCC(C)NC(=O)CSc1nnc(C2CC2)n1CCC(N)=O |
| InChI | InChI=1S/C17H29N5O2S/c1-3-4-5-6-12(2)19-15(24)11-25-17-21-20-16(13-7-8-13)22(17)10-9-14(18)23/h12-13H,3-11H2,1-2H3,(H2,18,23)(H,19,24) |
| InChIKey | HKPWWDQRCBUIND-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|