C18H25N3OS — CID 4652862
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]cyclohexanecarboxamide (PubChem CID 4652862) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]cyclohexanecarboxamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4652862 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]cyclohexanecarboxamide |
| SMILES | CSCCC(NC(=O)C1CCCCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H25N3OS/c1-23-12-11-16(21-18(22)13-7-3-2-4-8-13)17-19-14-9-5-6-10-15(14)20-17/h5-6,9-10,13,16H,2-4,7-8,11-12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QCFABUCGHMDLHD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |