C19H20ClNO3S — CID 46530131
methyl 4-[2-[3-(4-chlorophenyl)sulfanylpropanoylamino]ethyl]benzoate (PubChem CID 46530131) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is methyl 4-[2-[3-(4-chlorophenyl)sulfanylpropanoylamino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[3-(4-chlorophenyl)sulfanylpropanoylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 46530131 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 4-[2-[3-(4-chlorophenyl)sulfanylpropanoylamino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCNC(=O)CCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClNO3S/c1-24-19(23)15-4-2-14(3-5-15)10-12-21-18(22)11-13-25-17-8-6-16(20)7-9-17/h2-9H,10-13H2,1H3,(H,21,22) |
| InChIKey | IGMDZJVPUPQJEB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |