C21H26ClNO3S — CID 95091662
4-(4-chlorophenyl)sulfanyl-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide (PubChem CID 95091662) has the molecular formula C21H26ClNO3S and a molecular weight of 407.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 95091662 |
| Molecular Formula | C21H26ClNO3S |
| Molecular Weight | 407.96 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide |
| SMILES | COc1ccc(CCCNC(=O)CCCSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H26ClNO3S/c1-25-19-12-7-16(15-20(19)26-2)5-3-13-23-21(24)6-4-14-27-18-10-8-17(22)9-11-18/h7-12,15H,3-6,13-14H2,1-2H3,(H,23,24) |
| InChIKey | JMRPQYPVNARABB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.96 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|