C14H16N4O3S — CID 46533069
N-[[3-(methanesulfonamido)phenyl]methyl]-5-methylpyrazine-2-carboxamide (PubChem CID 46533069) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[[3-(methanesulfonamido)phenyl]methyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[[3-(methanesulfonamido)phenyl]methyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 46533069 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[[3-(methanesulfonamido)phenyl]methyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCc2cccc(NS(C)(=O)=O)c2)cn1 |
| InChI | InChI=1S/C14H16N4O3S/c1-10-7-16-13(9-15-10)14(19)17-8-11-4-3-5-12(6-11)18-22(2,20)21/h3-7,9,18H,8H2,1-2H3,(H,17,19) |
| InChIKey | ZPRNGCMKGGGHGA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |