C25H23ClN2O2 — CID 46533575
N-[3-[1-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]-methylamino]ethyl]phenyl]benzamide (PubChem CID 46533575) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-[3-[1-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]-methylamino]ethyl]phenyl]benzamide.
| Compound Name | N-[3-[1-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]-methylamino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46533575 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[3-[1-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]-methylamino]ethyl]phenyl]benzamide |
| SMILES | CC(c1cccc(NC(=O)c2ccccc2)c1)N(C)C(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN2O2/c1-18(28(2)24(29)16-15-19-9-6-7-14-23(19)26)21-12-8-13-22(17-21)27-25(30)20-10-4-3-5-11-20/h3-18H,1-2H3,(H,27,30)/b16-15+ |
| InChIKey | AYNCYYOJBQUSBU-FOCLMDBBSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|