C26H31N5OS — CID 46534112
2-phenyl-2-phenylsulfanyl-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 46534112) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 2-phenyl-2-phenylsulfanyl-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-phenyl-2-phenylsulfanyl-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46534112 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-phenyl-2-phenylsulfanyl-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(C(Sc1ccccc1)c1ccccc1)N1CCN(Cc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C26H31N5OS/c32-26(25(21-10-4-1-5-11-21)33-22-12-6-2-7-13-22)30-18-16-29(17-19-30)20-24-28-27-23-14-8-3-9-15-31(23)24/h1-2,4-7,10-13,25H,3,8-9,14-20H2 |
| InChIKey | WLBZPUPJKSACPU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |