C23H27N5O — CID 46449540
naphthalen-1-yl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 46449540) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is naphthalen-1-yl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | naphthalen-1-yl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46449540 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | naphthalen-1-yl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCN(Cc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C23H27N5O/c29-23(20-10-6-8-18-7-3-4-9-19(18)20)27-15-13-26(14-16-27)17-22-25-24-21-11-2-1-5-12-28(21)22/h3-4,6-10H,1-2,5,11-17H2 |
| InChIKey | MCSNOMMVDOVLNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |