C22H31N5O3 — CID 46469421
2-[(3-methoxyphenyl)methoxy]-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 46469421) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methoxy]-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3-methoxyphenyl)methoxy]-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46469421 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[(3-methoxyphenyl)methoxy]-1-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | COc1cccc(COCC(=O)N2CCN(Cc3nnc4n3CCCCC4)CC2)c1 |
| InChI | InChI=1S/C22H31N5O3/c1-29-19-7-5-6-18(14-19)16-30-17-22(28)26-12-10-25(11-13-26)15-21-24-23-20-8-3-2-4-9-27(20)21/h5-7,14H,2-4,8-13,15-17H2,1H3 |
| InChIKey | KHNLWOKQPSMCMQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |