C17H19FN2O6S — CID 46534971
N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 46534971) has the molecular formula C17H19FN2O6S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46534971 |
| Molecular Formula | C17H19FN2O6S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | COc1cc(CCNS(=O)(=O)c2ccc(F)cc2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H19FN2O6S/c1-11-8-13(18)4-5-17(11)27(23,24)19-7-6-12-9-15(25-2)16(26-3)10-14(12)20(21)22/h4-5,8-10,19H,6-7H2,1-3H3 |
| InChIKey | SZECWLABUZGLDH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|