C15H20N4O7S — CID 91651774
N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(methoxymethyl)pyrazole-3-sulfonamide (PubChem CID 91651774) has the molecular formula C15H20N4O7S and a molecular weight of 400.41 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(methoxymethyl)pyrazole-3-sulfonamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(methoxymethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 91651774 |
| Molecular Formula | C15H20N4O7S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(methoxymethyl)pyrazole-3-sulfonamide |
| SMILES | COCn1nccc1S(=O)(=O)NCCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O7S/c1-24-10-18-15(5-6-16-18)27(22,23)17-7-4-11-8-13(25-2)14(26-3)9-12(11)19(20)21/h5-6,8-9,17H,4,7,10H2,1-3H3 |
| InChIKey | RXCQWBIBUIJXFL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|