C20H23N5O5 — CID 46679770
N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 46679770) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 46679770 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2cnc3c(cnn3C(C)C)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H23N5O5/c1-12(2)24-19-14(11-23-24)7-15(10-22-19)20(26)21-6-5-13-8-17(29-3)18(30-4)9-16(13)25(27)28/h7-12H,5-6H2,1-4H3,(H,21,26) |
| InChIKey | HOLPYAAVCSIKJC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|