C24H20ClN3O3S2 — CID 46543523
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 46543523) has the molecular formula C24H20ClN3O3S2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 46543523 |
| Molecular Formula | C24H20ClN3O3S2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(CCNC(=O)Cc3csc(-c4ccccc4Cl)n3)C2=O)cc1 |
| InChI | InChI=1S/C24H20ClN3O3S2/c1-15-6-8-16(9-7-15)12-20-23(30)28(24(31)33-20)11-10-26-21(29)13-17-14-32-22(27-17)18-4-2-3-5-19(18)25/h2-9,12,14H,10-11,13H2,1H3,(H,26,29)/b20-12- |
| InChIKey | TVTGKQMDQSSCKZ-NDENLUEZSA-N |
| XLogP | 5.17 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|