C17H13ClFN3O4 — CID 46544136
[3-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methyl 2-amino-4-chlorobenzoate (PubChem CID 46544136) has the molecular formula C17H13ClFN3O4 and a molecular weight of 377.76 g/mol. Its IUPAC name is [3-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methyl 2-amino-4-chlorobenzoate.
| Compound Name | [3-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methyl 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 46544136 |
| Molecular Formula | C17H13ClFN3O4 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [3-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methyl 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCc1nc(COc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H13ClFN3O4/c18-10-1-6-13(14(20)7-10)17(23)25-9-16-21-15(22-26-16)8-24-12-4-2-11(19)3-5-12/h1-7H,8-9,20H2 |
| InChIKey | WKAQJZXCRFQESV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|