C19H15ClN2OS — CID 46546069
(2-chloro-4-pyridinyl)-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (PubChem CID 46546069) has the molecular formula C19H15ClN2OS and a molecular weight of 354.86 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone.
| Compound Name | (2-chloro-4-pyridinyl)-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 46546069 |
| Molecular Formula | C19H15ClN2OS |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (2-chloro-4-pyridinyl)-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2OS/c20-17-12-14(6-9-21-17)19(23)22-10-7-16-15(8-11-24-16)18(22)13-4-2-1-3-5-13/h1-6,8-9,11-12,18H,7,10H2 |
| InChIKey | WFMYBMBLGCMFEO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|