C19H14Cl2N2OS — CID 9245818
(5,6-dichloro-3-pyridinyl)-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone (PubChem CID 9245818) has the molecular formula C19H14Cl2N2OS and a molecular weight of 389.31 g/mol. Its IUPAC name is (5,6-dichloro-3-pyridinyl)-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone.
| Compound Name | (5,6-dichloro-3-pyridinyl)-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 9245818 |
| Molecular Formula | C19H14Cl2N2OS |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (5,6-dichloro-3-pyridinyl)-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
| SMILES | O=C(c1cnc(Cl)c(Cl)c1)N1CCc2sccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2OS/c20-15-10-13(11-22-18(15)21)19(24)23-8-6-16-14(7-9-25-16)17(23)12-4-2-1-3-5-12/h1-5,7,9-11,17H,6,8H2/t17-/m0/s1 |
| InChIKey | MVRMHMPZJSBOKA-KRWDZBQOSA-N |
| XLogP | 5.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|