C20H15ClN2O3S — CID 9245809
(2-chloro-4-nitrophenyl)-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone (PubChem CID 9245809) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 9245809 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N1CCc2sccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O3S/c21-17-12-14(23(25)26)6-7-15(17)20(24)22-10-8-18-16(9-11-27-18)19(22)13-4-2-1-3-5-13/h1-7,9,11-12,19H,8,10H2/t19-/m1/s1 |
| InChIKey | BTMSITJLUONNNW-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|