C23H23N3O5S — CID 46552290
2-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 46552290) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46552290 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2nnc(SCc3coc(-c4ccc(C)cc4C)n3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23N3O5S/c1-13-6-7-17(14(2)8-13)22-24-16(11-30-22)12-32-23-26-25-21(31-23)15-9-18(27-3)20(29-5)19(10-15)28-4/h6-11H,12H2,1-5H3 |
| InChIKey | RQNMLVBBLSMTKL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 92.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |